C19H26F4O — CID 144809566
(7Z)-3,3,4,4-tetrafluoro-2-methyl-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene (PubChem CID 144809566) has the molecular formula C19H26F4O and a molecular weight of 346.41 g/mol. Its IUPAC name is (7Z)-3,3,4,4-tetrafluoro-2-methyl-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene.
| Compound Name | (7Z)-3,3,4,4-tetrafluoro-2-methyl-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene |
|---|---|
| PubChem CID | 144809566 |
| Molecular Formula | C19H26F4O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (7Z)-3,3,4,4-tetrafluoro-2-methyl-5,6,9-trimethylidene-10-(2-methylpropoxy)undeca-1,7-diene |
| SMILES | C=C(/C=C\C(=C)C(C)OCC(C)C)C(=C)C(F)(F)C(F)(F)C(=C)C |
| InChI | InChI=1S/C19H26F4O/c1-12(2)11-24-17(8)15(6)10-9-14(5)16(7)19(22,23)18(20,21)13(3)4/h9-10,12,17H,3,5-7,11H2,1-2,4,8H3/b10-9- |
| InChIKey | GIVJWQWXBJXFPL-KTKRTIGZSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|