C12H25NO2 — CID 144812856
8,8-dimethyl-2,3,4a,5,6,7,9,9a-octahydro-[1,4]dioxino[2,3-c]azepine;ethane (PubChem CID 144812856) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 8,8-dimethyl-2,3,4a,5,6,7,9,9a-octahydro-[1,4]dioxino[2,3-c]azepine;ethane.
| Compound Name | 8,8-dimethyl-2,3,4a,5,6,7,9,9a-octahydro-[1,4]dioxino[2,3-c]azepine;ethane |
|---|---|
| PubChem CID | 144812856 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 8,8-dimethyl-2,3,4a,5,6,7,9,9a-octahydro-[1,4]dioxino[2,3-c]azepine;ethane |
| SMILES | CC.CC1(C)CNCC2OCCOC2C1 |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-10(2)5-8-9(6-11-7-10)13-4-3-12-8;1-2/h8-9,11H,3-7H2,1-2H3;1-2H3 |
| InChIKey | UWQFQZFWXJIQAG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |