C8H17N3O — CID 144817482
1-(aminomethyl)-3,3,4-trimethylpiperazin-2-one (PubChem CID 144817482) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(aminomethyl)-3,3,4-trimethylpiperazin-2-one.
| Compound Name | 1-(aminomethyl)-3,3,4-trimethylpiperazin-2-one |
|---|---|
| PubChem CID | 144817482 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1-(aminomethyl)-3,3,4-trimethylpiperazin-2-one |
| SMILES | CN1CCN(CN)C(=O)C1(C)C |
| InChI | InChI=1S/C8H17N3O/c1-8(2)7(12)11(6-9)5-4-10(8)3/h4-6,9H2,1-3H3 |
| InChIKey | AHCJTRAJZYOVIG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |