C21H21N7O4 — CID 144820492
1-(4-methoxyphenyl)-5-(4-methylphenyl)tetrazole;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 144820492) has the molecular formula C21H21N7O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-(4-methylphenyl)tetrazole;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 1-(4-methoxyphenyl)-5-(4-methylphenyl)tetrazole;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 144820492 |
| Molecular Formula | C21H21N7O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-(4-methylphenyl)tetrazole;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | CC1Cn2cc([N+](=O)[O-])nc2O1.COc1ccc(-n2nnnc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H14N4O.C6H7N3O3/c1-11-3-5-12(6-4-11)15-16-17-18-19(15)13-7-9-14(20-2)10-8-13;1-4-2-8-3-5(9(10)11)7-6(8)12-4/h3-10H,1-2H3;3-4H,2H2,1H3 |
| InChIKey | ZRQLQBQGHJBJKN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|