C40H52FNS — CID 144827646
1-(amino-butan-2-yl-fluoro-λ4-sulfanyl)-2-methyl-4-phenyl-3-[(3E)-2,3,5-trimethylhexa-3,5-dien-2-yl]benzene;5,5,6-trimethylbenzo[7]annulene (PubChem CID 144827646) has the molecular formula C40H52FNS and a molecular weight of 597.93 g/mol. Its IUPAC name is 1-(amino-butan-2-yl-fluoro-λ4-sulfanyl)-2-methyl-4-phenyl-3-[(3E)-2,3,5-trimethylhexa-3,5-dien-2-yl]benzene;5,5,6-trimethylbenzo[7]annulene.
| Compound Name | 1-(amino-butan-2-yl-fluoro-λ4-sulfanyl)-2-methyl-4-phenyl-3-[(3E)-2,3,5-trimethylhexa-3,5-dien-2-yl]benzene;5,5,6-trimethylbenzo[7]annulene |
|---|---|
| PubChem CID | 144827646 |
| Molecular Formula | C40H52FNS |
| Molecular Weight | 597.93 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | 1-(amino-butan-2-yl-fluoro-λ4-sulfanyl)-2-methyl-4-phenyl-3-[(3E)-2,3,5-trimethylhexa-3,5-dien-2-yl]benzene;5,5,6-trimethylbenzo[7]annulene |
| SMILES | C=C(C)/C=C(\C)C(C)(C)c1c(-c2ccccc2)ccc(S(N)(F)C(C)CC)c1C.CC1=CC=Cc2ccccc2C1(C)C |
| InChI | InChI=1S/C26H36FNS.C14H16/c1-9-20(5)29(27,28)24-16-15-23(22-13-11-10-12-14-22)25(21(24)6)26(7,8)19(4)17-18(2)3;1-11-7-6-9-12-8-4-5-10-13(12)14(11,2)3/h10-17,20H,2,9,28H2,1,3-8H3;4-10H,1-3H3/b19-17+; |
| InChIKey | LSWFZNBILVYFLH-ZJSKVYKZSA-N |
| XLogP | 12.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.93 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|