C12H15FIN5O2 — CID 144829065
[(2S)-2-(fluoromethyl)-5-[6-(iodoamino)purin-9-yl]-4-methyloxolan-2-yl]methanol (PubChem CID 144829065) has the molecular formula C12H15FIN5O2 and a molecular weight of 407.19 g/mol. Its IUPAC name is [(2S)-2-(fluoromethyl)-5-[6-(iodoamino)purin-9-yl]-4-methyloxolan-2-yl]methanol.
| Compound Name | [(2S)-2-(fluoromethyl)-5-[6-(iodoamino)purin-9-yl]-4-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 144829065 |
| Molecular Formula | C12H15FIN5O2 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [(2S)-2-(fluoromethyl)-5-[6-(iodoamino)purin-9-yl]-4-methyloxolan-2-yl]methanol |
| SMILES | CC1C[C@](CO)(CF)OC1n1cnc2c(NI)ncnc21 |
| InChI | InChI=1S/C12H15FIN5O2/c1-7-2-12(3-13,4-20)21-11(7)19-6-17-8-9(18-14)15-5-16-10(8)19/h5-7,11,20H,2-4H2,1H3,(H,15,16,18)/t7?,11?,12-/m1/s1 |
| InChIKey | OYAUDTKUIBKOQJ-BEUCVMACSA-N |
| XLogP | 1.84 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|