C36H34BNO2 — CID 144830812
9-phenyl-3-(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole (PubChem CID 144830812) has the molecular formula C36H34BNO2 and a molecular weight of 523.49 g/mol. Its IUPAC name is 9-phenyl-3-(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole.
| Compound Name | 9-phenyl-3-(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole |
|---|---|
| PubChem CID | 144830812 |
| Molecular Formula | C36H34BNO2 |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 9-phenyl-3-(4-phenylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole |
| SMILES | CC1(C)OB(c2ccc3c4c(n(-c5ccccc5)c3c2)=CCC(c2ccc(-c3ccccc3)cc2)C=4)OC1(C)C |
| InChI | InChI=1S/C36H34BNO2/c1-35(2)36(3,4)40-37(39-35)29-20-21-31-32-23-28(27-17-15-26(16-18-27)25-11-7-5-8-12-25)19-22-33(32)38(34(31)24-29)30-13-9-6-10-14-30/h5-18,20-24,28H,19H2,1-4H3 |
| InChIKey | KENNJMVDMBUPPR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|