C36H33BN2O2 — CID 166009382
5,7-diphenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5a,12a-dihydroindolo[2,3-b]carbazole (PubChem CID 166009382) has the molecular formula C36H33BN2O2 and a molecular weight of 536.48 g/mol. Its IUPAC name is 5,7-diphenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5a,12a-dihydroindolo[2,3-b]carbazole.
| Compound Name | 5,7-diphenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5a,12a-dihydroindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 166009382 |
| Molecular Formula | C36H33BN2O2 |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 5,7-diphenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5a,12a-dihydroindolo[2,3-b]carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2C=c4c(n(-c5ccccc5)c5ccccc45)=CC2N3c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C36H33BN2O2/c1-35(2)36(3,4)41-37(40-35)24-19-20-32-28(21-24)30-22-29-27-17-11-12-18-31(27)38(25-13-7-5-8-14-25)33(29)23-34(30)39(32)26-15-9-6-10-16-26/h5-23,30,34H,1-4H3 |
| InChIKey | ZMRVXNWHRHRGFG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|