C25H24N4O4 — CID 144831872
N,2-dimethyl-6-[[2-[2-(prop-2-enoylamino)anilino]-4-pyridinyl]oxy]-4,5-dihydro-1-benzofuran-3-carboxamide (PubChem CID 144831872) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N,2-dimethyl-6-[[2-[2-(prop-2-enoylamino)anilino]-4-pyridinyl]oxy]-4,5-dihydro-1-benzofuran-3-carboxamide.
| Compound Name | N,2-dimethyl-6-[[2-[2-(prop-2-enoylamino)anilino]-4-pyridinyl]oxy]-4,5-dihydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 144831872 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N,2-dimethyl-6-[[2-[2-(prop-2-enoylamino)anilino]-4-pyridinyl]oxy]-4,5-dihydro-1-benzofuran-3-carboxamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc(OC2=Cc3oc(C)c(C(=O)NC)c3CC2)ccn1 |
| InChI | InChI=1S/C25H24N4O4/c1-4-23(30)29-20-8-6-5-7-19(20)28-22-14-17(11-12-27-22)33-16-9-10-18-21(13-16)32-15(2)24(18)25(31)26-3/h4-8,11-14H,1,9-10H2,2-3H3,(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | GJYRJNLFDAXRBH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|