C20H24ClN3O2 — CID 144837688
2-(4-chlorophenyl)-6-(2-hydroxyethyl)-7-methyl-1-pentylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 144837688) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-(2-hydroxyethyl)-7-methyl-1-pentylimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 2-(4-chlorophenyl)-6-(2-hydroxyethyl)-7-methyl-1-pentylimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 144837688 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-(4-chlorophenyl)-6-(2-hydroxyethyl)-7-methyl-1-pentylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCn1c(-c2ccc(Cl)cc2)cn2c(=O)c(CCO)c(C)nc12 |
| InChI | InChI=1S/C20H24ClN3O2/c1-3-4-5-11-23-18(15-6-8-16(21)9-7-15)13-24-19(26)17(10-12-25)14(2)22-20(23)24/h6-9,13,25H,3-5,10-12H2,1-2H3 |
| InChIKey | GCOVRXXDZNVJTB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|