C19H26N4O2 — CID 144838858
1-[2-[(E)-2-(2,5-dimethylphenyl)ethenyl]-3-methoxyphenyl]-1-methylhydrazine;formohydrazide (PubChem CID 144838858) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[2-[(E)-2-(2,5-dimethylphenyl)ethenyl]-3-methoxyphenyl]-1-methylhydrazine;formohydrazide.
| Compound Name | 1-[2-[(E)-2-(2,5-dimethylphenyl)ethenyl]-3-methoxyphenyl]-1-methylhydrazine;formohydrazide |
|---|---|
| PubChem CID | 144838858 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[2-[(E)-2-(2,5-dimethylphenyl)ethenyl]-3-methoxyphenyl]-1-methylhydrazine;formohydrazide |
| SMILES | COc1cccc(N(C)N)c1/C=C/c1cc(C)ccc1C.NNC=O |
| InChI | InChI=1S/C18H22N2O.CH4N2O/c1-13-8-9-14(2)15(12-13)10-11-16-17(20(3)19)6-5-7-18(16)21-4;2-3-1-4/h5-12H,19H2,1-4H3;1H,2H2,(H,3,4)/b11-10+; |
| InChIKey | IJGXBORUGVZODE-ASTDGNLGSA-N |
| XLogP | 2.40 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|