C17H15N3O7 — CID 144839196
acetic acid;1-[4-(2,4-dinitrophenyl)phenyl]-2-iminopropan-1-one (PubChem CID 144839196) has the molecular formula C17H15N3O7 and a molecular weight of 373.32 g/mol. Its IUPAC name is acetic acid;1-[4-(2,4-dinitrophenyl)phenyl]-2-iminopropan-1-one.
| Compound Name | acetic acid;1-[4-(2,4-dinitrophenyl)phenyl]-2-iminopropan-1-one |
|---|---|
| PubChem CID | 144839196 |
| Molecular Formula | C17H15N3O7 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | acetic acid;1-[4-(2,4-dinitrophenyl)phenyl]-2-iminopropan-1-one |
| SMILES | CC(=O)O.[H]/N=C(\C)C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O5.C2H4O2/c1-9(16)15(19)11-4-2-10(3-5-11)13-7-6-12(17(20)21)8-14(13)18(22)23;1-2(3)4/h2-8,16H,1H3;1H3,(H,3,4)/b16-9+; |
| InChIKey | FZUCJUUPXLTSNE-QOVZSLTQSA-N |
| XLogP | 3.48 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|