C27H31N3O7 — CID 144839227
(3E)-1-[4-(2,4-dinitrophenyl)phenyl]-3-ethenyl-2-iminohexa-3,5-dien-1-one;ethane;pentanoic acid (PubChem CID 144839227) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is (3E)-1-[4-(2,4-dinitrophenyl)phenyl]-3-ethenyl-2-iminohexa-3,5-dien-1-one;ethane;pentanoic acid.
| Compound Name | (3E)-1-[4-(2,4-dinitrophenyl)phenyl]-3-ethenyl-2-iminohexa-3,5-dien-1-one;ethane;pentanoic acid |
|---|---|
| PubChem CID | 144839227 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (3E)-1-[4-(2,4-dinitrophenyl)phenyl]-3-ethenyl-2-iminohexa-3,5-dien-1-one;ethane;pentanoic acid |
| SMILES | CC.CCCCC(=O)O.[H]/N=C(C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1)\C(C=C)=C\C=C |
| InChI | InChI=1S/C20H15N3O5.C5H10O2.C2H6/c1-3-5-13(4-2)19(21)20(24)15-8-6-14(7-9-15)17-11-10-16(22(25)26)12-18(17)23(27)28;1-2-3-4-5(6)7;1-2/h3-12,21H,1-2H2;2-4H2,1H3,(H,6,7);1-2H3/b13-5+,21-19+;; |
| InChIKey | RIXGUWIAYGJITO-CFGHEIKDSA-N |
| XLogP | 6.96 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|