C31H25N3 — CID 144839302
2-[(1E)-1-(8-methyl-4-prop-1-en-2-ylquinolin-7-yl)-3-phenylbuta-1,3-dienyl]quinazoline (PubChem CID 144839302) has the molecular formula C31H25N3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[(1E)-1-(8-methyl-4-prop-1-en-2-ylquinolin-7-yl)-3-phenylbuta-1,3-dienyl]quinazoline.
| Compound Name | 2-[(1E)-1-(8-methyl-4-prop-1-en-2-ylquinolin-7-yl)-3-phenylbuta-1,3-dienyl]quinazoline |
|---|---|
| PubChem CID | 144839302 |
| Molecular Formula | C31H25N3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[(1E)-1-(8-methyl-4-prop-1-en-2-ylquinolin-7-yl)-3-phenylbuta-1,3-dienyl]quinazoline |
| SMILES | C=C(/C=C(/c1ncc2ccccc2n1)c1ccc2c(C(=C)C)ccnc2c1C)c1ccccc1 |
| InChI | InChI=1S/C31H25N3/c1-20(2)25-16-17-32-30-22(4)26(14-15-27(25)30)28(18-21(3)23-10-6-5-7-11-23)31-33-19-24-12-8-9-13-29(24)34-31/h5-19H,1,3H2,2,4H3/b28-18+ |
| InChIKey | JVWKHIJMYJVFRH-MTDXEUNCSA-N |
| XLogP | 7.66 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|