C24H23N — CID 144969438
8-methyl-5-[(2E)-4-phenylpenta-2,4-dien-2-yl]-7-[(Z)-prop-1-enyl]quinoline (PubChem CID 144969438) has the molecular formula C24H23N and a molecular weight of 325.46 g/mol. Its IUPAC name is 8-methyl-5-[(2E)-4-phenylpenta-2,4-dien-2-yl]-7-[(Z)-prop-1-enyl]quinoline.
| Compound Name | 8-methyl-5-[(2E)-4-phenylpenta-2,4-dien-2-yl]-7-[(Z)-prop-1-enyl]quinoline |
|---|---|
| PubChem CID | 144969438 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 8-methyl-5-[(2E)-4-phenylpenta-2,4-dien-2-yl]-7-[(Z)-prop-1-enyl]quinoline |
| SMILES | C=C(/C=C(\C)c1cc(/C=C\C)c(C)c2ncccc12)c1ccccc1 |
| InChI | InChI=1S/C24H23N/c1-5-10-21-16-23(22-13-9-14-25-24(22)19(21)4)18(3)15-17(2)20-11-7-6-8-12-20/h5-16H,2H2,1,3-4H3/b10-5-,18-15+ |
| InChIKey | YYEOLVUHBPNQOJ-JJDRHRIQSA-N |
| XLogP | 6.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|