C27H37N5O4 — CID 144840285
4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-[2-(ethylamino)-2-oxoethanimidoyl]amino]-N-(4-methylpentan-2-yl)benzamide (PubChem CID 144840285) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-[2-(ethylamino)-2-oxoethanimidoyl]amino]-N-(4-methylpentan-2-yl)benzamide.
| Compound Name | 4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-[2-(ethylamino)-2-oxoethanimidoyl]amino]-N-(4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 144840285 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 4-[(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-[2-(ethylamino)-2-oxoethanimidoyl]amino]-N-(4-methylpentan-2-yl)benzamide |
| SMILES | [H]/N=C(\C(=O)NCC)N(/C(=N/[H])c1cc(C(C)C)c(O)cc1O)c1ccc(C(=O)NC(C)CC(C)C)cc1 |
| InChI | InChI=1S/C27H37N5O4/c1-7-30-27(36)25(29)32(24(28)21-13-20(16(4)5)22(33)14-23(21)34)19-10-8-18(9-11-19)26(35)31-17(6)12-15(2)3/h8-11,13-17,28-29,33-34H,7,12H2,1-6H3,(H,30,36)(H,31,35)/b28-24+,29-25+ |
| InChIKey | KKXGUKAYWHFQIK-NLLYGJECSA-N |
| XLogP | 4.33 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|