C25H29NO5 — CID 144846181
ethane;phenyl N-(2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-6-yl)carbamate (PubChem CID 144846181) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is ethane;phenyl N-(2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-6-yl)carbamate.
| Compound Name | ethane;phenyl N-(2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-6-yl)carbamate |
|---|---|
| PubChem CID | 144846181 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethane;phenyl N-(2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-6-yl)carbamate |
| SMILES | CC.COC1=CCC2C(NC(=O)Oc3ccccc3)Cc3ccc(OC)c4c3C2C1O4 |
| InChI | InChI=1S/C23H23NO5.C2H6/c1-26-17-10-8-13-12-16(24-23(25)28-14-6-4-3-5-7-14)15-9-11-18(27-2)22-20(15)19(13)21(17)29-22;1-2/h3-8,10-11,15-16,20,22H,9,12H2,1-2H3,(H,24,25);1-2H3 |
| InChIKey | FKMDKIVOXDJKSZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |