C17H20O5 — CID 10662273
methyl (1S,2R,5S,6S,14R)-2-hydroxy-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylate (PubChem CID 10662273) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is methyl (1S,2R,5S,6S,14R)-2-hydroxy-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylate.
| Compound Name | methyl (1S,2R,5S,6S,14R)-2-hydroxy-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylate |
|---|---|
| PubChem CID | 10662273 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl (1S,2R,5S,6S,14R)-2-hydroxy-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2ccc(OC)c3c2[C@H]2[C@@H]1CC[C@@H](O)[C@H]2O3 |
| InChI | InChI=1S/C17H20O5/c1-20-12-6-3-8-7-10(17(19)21-2)9-4-5-11(18)15-14(9)13(8)16(12)22-15/h3,6,9-11,14-15,18H,4-5,7H2,1-2H3/t9-,10+,11-,14-,15-/m1/s1 |
| InChIKey | RYPXKPQFDMGQRZ-SPSJUYOASA-N |
| XLogP | 1.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |