C18H22O6 — CID 10568713
(1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylic acid (PubChem CID 10568713) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylic acid.
| Compound Name | (1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 10568713 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-6-carboxylic acid |
| SMILES | COCO[C@H]1CC[C@H]2[C@@H]3c4c(ccc(OC)c4O[C@@H]31)C[C@@H]2C(=O)O |
| InChI | InChI=1S/C18H22O6/c1-21-8-23-13-6-4-10-11(18(19)20)7-9-3-5-12(22-2)16-14(9)15(10)17(13)24-16/h3,5,10-11,13,15,17H,4,6-8H2,1-2H3,(H,19,20)/t10-,11+,13+,15-,17-/m1/s1 |
| InChIKey | WTCMIGIGIAGKHK-ZKRLBSCHSA-N |
| XLogP | 2.20 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|