C16H18O3 — CID 134526022
(12S)-2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),10-tetraene (PubChem CID 134526022) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (12S)-2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),10-tetraene.
| Compound Name | (12S)-2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),10-tetraene |
|---|---|
| PubChem CID | 134526022 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (12S)-2,11-dimethoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),10-tetraene |
| SMILES | COC1=CCC2CCc3ccc(OC)c4c3C2[C@@H]1O4 |
| InChI | InChI=1S/C16H18O3/c1-17-11-7-5-9-3-4-10-6-8-12(18-2)16-14(10)13(9)15(11)19-16/h5,7-8,10,14,16H,3-4,6H2,1-2H3/t10?,14?,16-/m1/s1 |
| InChIKey | TZDGYJIPNKMXLK-DARSQCIJSA-N |
| XLogP | 3.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |