C18H25NO3 — CID 147763261
(1S,2S,6S)-6-[ethyl(methyl)amino]-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol (PubChem CID 147763261) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (1S,2S,6S)-6-[ethyl(methyl)amino]-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol.
| Compound Name | (1S,2S,6S)-6-[ethyl(methyl)amino]-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol |
|---|---|
| PubChem CID | 147763261 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1S,2S,6S)-6-[ethyl(methyl)amino]-11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol |
| SMILES | CCN(C)[C@H]1Cc2ccc(OC)c3c2C2C1CC[C@H](O)[C@H]2O3 |
| InChI | InChI=1S/C18H25NO3/c1-4-19(2)12-9-10-5-8-14(21-3)18-15(10)16-11(12)6-7-13(20)17(16)22-18/h5,8,11-13,16-17,20H,4,6-7,9H2,1-3H3/t11?,12-,13-,16?,17+/m0/s1 |
| InChIKey | HEMMRTKIEDAWNE-VRJNADHRSA-N |
| XLogP | 2.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |