C15H16O3 — CID 170196060
11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-ol (PubChem CID 170196060) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-ol.
| Compound Name | 11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-ol |
|---|---|
| PubChem CID | 170196060 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 11-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-ol |
| SMILES | COc1ccc2c3c1OC1C(O)C=CC(CC2)C31 |
| InChI | InChI=1S/C15H16O3/c1-17-11-7-5-9-3-2-8-4-6-10(16)14-12(8)13(9)15(11)18-14/h4-8,10,12,14,16H,2-3H2,1H3 |
| InChIKey | ASUNPYSQRMXMBP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|