C19H22N2O5 — CID 100993541
2-diazo-1-[(1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]ethanone (PubChem CID 100993541) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-diazo-1-[(1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]ethanone.
| Compound Name | 2-diazo-1-[(1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]ethanone |
|---|---|
| PubChem CID | 100993541 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-diazo-1-[(1S,2S,5S,6S,14R)-11-methoxy-2-(methoxymethoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]ethanone |
| SMILES | COCO[C@H]1CC[C@H]2[C@@H]3c4c(ccc(OC)c4O[C@@H]31)C[C@@H]2C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C19H22N2O5/c1-23-9-25-15-6-4-11-12(13(22)8-21-20)7-10-3-5-14(24-2)18-16(10)17(11)19(15)26-18/h3,5,8,11-12,15,17,19H,4,6-7,9H2,1-2H3/t11-,12+,15+,17-,19-/m1/s1 |
| InChIKey | IFVCQDYTKSTDOF-WTWCFYEXSA-N |
| XLogP | 1.98 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|