C30H32FN3O2S — CID 144850254
4-(azetidin-3-ylmethoxy)-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide;4-[(1S)-1-phenylethyl]benzonitrile (PubChem CID 144850254) has the molecular formula C30H32FN3O2S and a molecular weight of 517.67 g/mol. Its IUPAC name is 4-(azetidin-3-ylmethoxy)-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide;4-[(1S)-1-phenylethyl]benzonitrile.
| Compound Name | 4-(azetidin-3-ylmethoxy)-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide;4-[(1S)-1-phenylethyl]benzonitrile |
|---|---|
| PubChem CID | 144850254 |
| Molecular Formula | C30H32FN3O2S |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 4-(azetidin-3-ylmethoxy)-5-cyclopropyl-2-fluoro-N-methylsulfanylbenzamide;4-[(1S)-1-phenylethyl]benzonitrile |
| SMILES | CSNC(=O)c1cc(C2CC2)c(OCC2CNC2)cc1F.C[C@@H](c1ccccc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H19FN2O2S.C15H13N/c1-21-18-15(19)12-4-11(10-2-3-10)14(5-13(12)16)20-8-9-6-17-7-9;1-12(14-5-3-2-4-6-14)15-9-7-13(11-16)8-10-15/h4-5,9-10,17H,2-3,6-8H2,1H3,(H,18,19);2-10,12H,1H3/t;12-/m.0/s1 |
| InChIKey | WJANVBUMHIELRX-WKEFIFSLSA-N |
| XLogP | 6.02 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|