C29H42FN7O6 — CID 14485155
acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(2-fluorophenyl)ethyl]amino]-2-oxoethyl]pentanamide (PubChem CID 14485155) has the molecular formula C29H42FN7O6 and a molecular weight of 603.70 g/mol. Its IUPAC name is acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(2-fluorophenyl)ethyl]amino]-2-oxoethyl]pentanamide.
| Compound Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(2-fluorophenyl)ethyl]amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 14485155 |
| Molecular Formula | C29H42FN7O6 |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(2-fluorophenyl)ethyl]amino]-2-oxoethyl]pentanamide |
| SMILES | CC(=O)O.CCN(CCc1ccccc1F)C(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H38FN7O4.C2H4O2/c1-2-35(15-13-19-6-3-4-7-21(19)28)24(37)17-33-26(39)23(8-5-14-32-27(30)31)34-25(38)22(29)16-18-9-11-20(36)12-10-18;1-2(3)4/h3-4,6-7,9-12,22-23,36H,2,5,8,13-17,29H2,1H3,(H,33,39)(H,34,38)(H4,30,31,32);1H3,(H,3,4)/t22-,23+;/m0./s1 |
| InChIKey | ONOUJORDRHQPFK-PEADMDKFSA-N |
| XLogP | 0.24 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|