C29H44N8O7 — CID 14485222
acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(4-nitrophenyl)ethyl]amino]ethyl]pentanamide (PubChem CID 14485222) has the molecular formula C29H44N8O7 and a molecular weight of 616.72 g/mol. Its IUPAC name is acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(4-nitrophenyl)ethyl]amino]ethyl]pentanamide.
| Compound Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(4-nitrophenyl)ethyl]amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 14485222 |
| Molecular Formula | C29H44N8O7 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[2-(4-nitrophenyl)ethyl]amino]ethyl]pentanamide |
| SMILES | CC(=O)O.CCN(CCNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H40N8O5.C2H4O2/c1-2-34(16-13-19-5-9-21(10-6-19)35(39)40)17-15-31-26(38)24(4-3-14-32-27(29)30)33-25(37)23(28)18-20-7-11-22(36)12-8-20;1-2(3)4/h5-12,23-24,36H,2-4,13-18,28H2,1H3,(H,31,38)(H,33,37)(H4,29,30,32);1H3,(H,3,4)/t23-,24+;/m0./s1 |
| InChIKey | BKCUUZRTBYUXLY-KZDWWKKTSA-N |
| XLogP | 0.48 |
| TPSA | 252.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|