C33H45N7O6 — CID 14485188
acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl(2-naphthalen-1-ylethyl)amino]-2-oxoethyl]pentanamide (PubChem CID 14485188) has the molecular formula C33H45N7O6 and a molecular weight of 635.77 g/mol. Its IUPAC name is acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl(2-naphthalen-1-ylethyl)amino]-2-oxoethyl]pentanamide.
| Compound Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl(2-naphthalen-1-ylethyl)amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 14485188 |
| Molecular Formula | C33H45N7O6 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl(2-naphthalen-1-ylethyl)amino]-2-oxoethyl]pentanamide |
| SMILES | CC(=O)O.CCN(CCc1cccc2ccccc12)C(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C31H41N7O4.C2H4O2/c1-2-38(18-16-23-9-5-8-22-7-3-4-10-25(22)23)28(40)20-36-30(42)27(11-6-17-35-31(33)34)37-29(41)26(32)19-21-12-14-24(39)15-13-21;1-2(3)4/h3-5,7-10,12-15,26-27,39H,2,6,11,16-20,32H2,1H3,(H,36,42)(H,37,41)(H4,33,34,35);1H3,(H,3,4)/t26-,27+;/m0./s1 |
| InChIKey | JSUZUCYJPWPSJV-MFHXMFJOSA-N |
| XLogP | 1.25 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|