C29H41Cl2N7O6 — CID 14485161
acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[2-(3,4-dichlorophenyl)ethyl-ethylamino]-2-oxoethyl]pentanamide (PubChem CID 14485161) has the molecular formula C29H41Cl2N7O6 and a molecular weight of 654.60 g/mol. Its IUPAC name is acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[2-(3,4-dichlorophenyl)ethyl-ethylamino]-2-oxoethyl]pentanamide.
| Compound Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[2-(3,4-dichlorophenyl)ethyl-ethylamino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 14485161 |
| Molecular Formula | C29H41Cl2N7O6 |
| Molecular Weight | 654.60 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | acetic acid;(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[2-(3,4-dichlorophenyl)ethyl-ethylamino]-2-oxoethyl]pentanamide |
| SMILES | CC(=O)O.CCN(CCc1ccc(Cl)c(Cl)c1)C(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H37Cl2N7O4.C2H4O2/c1-2-36(13-11-18-7-10-20(28)21(29)14-18)24(38)16-34-26(40)23(4-3-12-33-27(31)32)35-25(39)22(30)15-17-5-8-19(37)9-6-17;1-2(3)4/h5-10,14,22-23,37H,2-4,11-13,15-16,30H2,1H3,(H,34,40)(H,35,39)(H4,31,32,33);1H3,(H,3,4)/t22-,23+;/m0./s1 |
| InChIKey | KIFNOJPTKXKDTK-PEADMDKFSA-N |
| XLogP | 1.41 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.60 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|