C28H40N8O6 — CID 14485216
(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[3-(4-nitrophenyl)propyl]amino]-2-oxoethyl]pentanamide (PubChem CID 14485216) has the molecular formula C28H40N8O6 and a molecular weight of 584.68 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[3-(4-nitrophenyl)propyl]amino]-2-oxoethyl]pentanamide.
| Compound Name | (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[3-(4-nitrophenyl)propyl]amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 14485216 |
| Molecular Formula | C28H40N8O6 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[2-[ethyl-[3-(4-nitrophenyl)propyl]amino]-2-oxoethyl]pentanamide |
| SMILES | CCN(CCCc1ccc([N+](=O)[O-])cc1)C(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C28H40N8O6/c1-2-35(16-4-5-19-7-11-21(12-8-19)36(41)42)25(38)18-33-27(40)24(6-3-15-32-28(30)31)34-26(39)23(29)17-20-9-13-22(37)14-10-20/h7-14,23-24,37H,2-6,15-18,29H2,1H3,(H,33,40)(H,34,39)(H4,30,31,32)/t23-,24+/m0/s1 |
| InChIKey | KOULWNLZFPSLQQ-BJKOFHAPSA-N |
| XLogP | 0.31 |
| TPSA | 232.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|