C11H15N3 — CID 144854974
4,7-dimethyl-3,5-dihydro-1,4-benzodiazepin-2-amine (PubChem CID 144854974) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4,7-dimethyl-3,5-dihydro-1,4-benzodiazepin-2-amine.
| Compound Name | 4,7-dimethyl-3,5-dihydro-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 144854974 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4,7-dimethyl-3,5-dihydro-1,4-benzodiazepin-2-amine |
| SMILES | Cc1ccc2c(c1)CN(C)CC(N)=N2 |
| InChI | InChI=1S/C11H15N3/c1-8-3-4-10-9(5-8)6-14(2)7-11(12)13-10/h3-5H,6-7H2,1-2H3,(H2,12,13) |
| InChIKey | SLKQWRCMZOMRQH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |