C30H48N7O7P — CID 144855434
tert-butyl N-[1-[[2-[2-[3-[2-(ethoxymethyl)-4-(N'-methylcarbamimidoyl)-5-phenylimidazol-1-yl]propylamino]-2-oxoethoxy]acetyl]amino]propan-2-yloxymethylphosphanyl]carbamate (PubChem CID 144855434) has the molecular formula C30H48N7O7P and a molecular weight of 649.73 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-[2-[3-[2-(ethoxymethyl)-4-(N'-methylcarbamimidoyl)-5-phenylimidazol-1-yl]propylamino]-2-oxoethoxy]acetyl]amino]propan-2-yloxymethylphosphanyl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-[2-[3-[2-(ethoxymethyl)-4-(N'-methylcarbamimidoyl)-5-phenylimidazol-1-yl]propylamino]-2-oxoethoxy]acetyl]amino]propan-2-yloxymethylphosphanyl]carbamate |
|---|---|
| PubChem CID | 144855434 |
| Molecular Formula | C30H48N7O7P |
| Molecular Weight | 649.73 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | tert-butyl N-[1-[[2-[2-[3-[2-(ethoxymethyl)-4-(N'-methylcarbamimidoyl)-5-phenylimidazol-1-yl]propylamino]-2-oxoethoxy]acetyl]amino]propan-2-yloxymethylphosphanyl]carbamate |
| SMILES | CCOCc1nc(/C(N)=N/C)c(-c2ccccc2)n1CCCNC(=O)COCC(=O)NCC(C)OCPNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H48N7O7P/c1-7-41-17-23-35-26(28(31)32-6)27(22-12-9-8-10-13-22)37(23)15-11-14-33-24(38)18-42-19-25(39)34-16-21(2)43-20-45-36-29(40)44-30(3,4)5/h8-10,12-13,21,45H,7,11,14-20H2,1-6H3,(H2,31,32)(H,33,38)(H,34,39)(H,36,40) |
| InChIKey | JPSJZYQYWHSDIA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|