C21H32N4O4S — CID 170000518
tert-butyl N-[4-[4-(ethoxymethyl)-8-methoxy-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-3-yl]butyl]carbamate (PubChem CID 170000518) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(ethoxymethyl)-8-methoxy-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-3-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(ethoxymethyl)-8-methoxy-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 170000518 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tert-butyl N-[4-[4-(ethoxymethyl)-8-methoxy-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-3-yl]butyl]carbamate |
| SMILES | CCOCc1nc2c(n1CCCCNC(=O)OC(C)(C)C)-c1sccc1N(OC)C2 |
| InChI | InChI=1S/C21H32N4O4S/c1-6-28-14-17-23-15-13-25(27-5)16-9-12-30-19(16)18(15)24(17)11-8-7-10-22-20(26)29-21(2,3)4/h9,12H,6-8,10-11,13-14H2,1-5H3,(H,22,26) |
| InChIKey | VXOLFSKJHKDFFN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|