C22H32 — CID 144855875
1-(4,4-dimethylpentan-2-yl)-4-[(1E,3E,5Z)-3-methylocta-1,3,5-trienyl]benzene (PubChem CID 144855875) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-(4,4-dimethylpentan-2-yl)-4-[(1E,3E,5Z)-3-methylocta-1,3,5-trienyl]benzene.
| Compound Name | 1-(4,4-dimethylpentan-2-yl)-4-[(1E,3E,5Z)-3-methylocta-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 144855875 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-(4,4-dimethylpentan-2-yl)-4-[(1E,3E,5Z)-3-methylocta-1,3,5-trienyl]benzene |
| SMILES | CC/C=C\C=C(C)\C=C\c1ccc(C(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32/c1-7-8-9-10-18(2)11-12-20-13-15-21(16-14-20)19(3)17-22(4,5)6/h8-16,19H,7,17H2,1-6H3/b9-8-,12-11+,18-10+ |
| InChIKey | QQBTUOHGOTTYRX-RRLOREPMSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|