C38H36N2S — CID 144856107
5,6-dimethyl-2-[4-[3-methyl-4-[(Z)-prop-1-enyl]acridin-9-yl]phenyl]-4,7-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-benzothiazole (PubChem CID 144856107) has the molecular formula C38H36N2S and a molecular weight of 552.79 g/mol. Its IUPAC name is 5,6-dimethyl-2-[4-[3-methyl-4-[(Z)-prop-1-enyl]acridin-9-yl]phenyl]-4,7-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-benzothiazole.
| Compound Name | 5,6-dimethyl-2-[4-[3-methyl-4-[(Z)-prop-1-enyl]acridin-9-yl]phenyl]-4,7-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 144856107 |
| Molecular Formula | C38H36N2S |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 5,6-dimethyl-2-[4-[3-methyl-4-[(Z)-prop-1-enyl]acridin-9-yl]phenyl]-4,7-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-benzothiazole |
| SMILES | C/C=C\c1c(C)c(C)c(/C=C\C)c2c1NC(c1ccc(-c3c4ccccc4nc4c(/C=C\C)c(C)ccc34)cc1)S2 |
| InChI | InChI=1S/C38H36N2S/c1-7-12-28-23(4)17-22-32-34(31-15-10-11-16-33(31)39-35(28)32)26-18-20-27(21-19-26)38-40-36-29(13-8-2)24(5)25(6)30(14-9-3)37(36)41-38/h7-22,38,40H,1-6H3/b12-7-,13-8-,14-9- |
| InChIKey | XGINHSZXYWOBBV-PEKHUZIYSA-N |
| XLogP | 11.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|