C17H30F2 — CID 144859039
1-(3,4-difluoro-5-methylheptan-2-yl)-4-[(E)-prop-1-enyl]cyclohexane (PubChem CID 144859039) has the molecular formula C17H30F2 and a molecular weight of 272.42 g/mol. Its IUPAC name is 1-(3,4-difluoro-5-methylheptan-2-yl)-4-[(E)-prop-1-enyl]cyclohexane.
| Compound Name | 1-(3,4-difluoro-5-methylheptan-2-yl)-4-[(E)-prop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 144859039 |
| Molecular Formula | C17H30F2 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(3,4-difluoro-5-methylheptan-2-yl)-4-[(E)-prop-1-enyl]cyclohexane |
| SMILES | C/C=C/C1CCC(C(C)C(F)C(F)C(C)CC)CC1 |
| InChI | InChI=1S/C17H30F2/c1-5-7-14-8-10-15(11-9-14)13(4)17(19)16(18)12(3)6-2/h5,7,12-17H,6,8-11H2,1-4H3/b7-5+ |
| InChIKey | UGYMPAYVQUHDIE-FNORWQNLSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|