C13H17ClN4 — CID 144863038
(3E)-3-(1-chloroethylidene)-5-(1-methylpyrazol-4-yl)-N-propyl-1H-pyrrol-2-imine (PubChem CID 144863038) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is (3E)-3-(1-chloroethylidene)-5-(1-methylpyrazol-4-yl)-N-propyl-1H-pyrrol-2-imine.
| Compound Name | (3E)-3-(1-chloroethylidene)-5-(1-methylpyrazol-4-yl)-N-propyl-1H-pyrrol-2-imine |
|---|---|
| PubChem CID | 144863038 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (3E)-3-(1-chloroethylidene)-5-(1-methylpyrazol-4-yl)-N-propyl-1H-pyrrol-2-imine |
| SMILES | CCC/N=C1\NC(c2cnn(C)c2)=C\C1=C(\C)Cl |
| InChI | InChI=1S/C13H17ClN4/c1-4-5-15-13-11(9(2)14)6-12(17-13)10-7-16-18(3)8-10/h6-8H,4-5H2,1-3H3,(H,15,17)/b11-9+ |
| InChIKey | YDXPMULFWFPPOA-PKNBQFBNSA-N |
| XLogP | 2.69 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|