About ethane;3-fluoro-2-methylaniline;methanimine
ethane;3-fluoro-2-methylaniline;methanimine (PubChem CID 144871990) has the molecular formula C11H20FN3
and a molecular weight of 213.30 g/mol. Its IUPAC name is ethane;3-fluoro-2-methylaniline;methanimine.
Molecular Properties
| Compound Name | ethane;3-fluoro-2-methylaniline;methanimine |
| PubChem CID | 144871990 |
| Molecular Formula | C11H20FN3 |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | ethane;3-fluoro-2-methylaniline;methanimine |
| SMILES | CC.Cc1c(N)cccc1F.[H]N=C.[H]N=C |
| InChI | InChI=1S/C7H8FN.C2H6.2CH3N/c1-5-6(8)3-2-4-7(5)9;3*1-2/h2-4H,9H2,1H3;1-2H3;2*2H,1H2 |
| InChIKey | LHJYSUJFNGEQFD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-fluoro-2-methylaniline;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-fluoro-2-methylaniline;methanimine?
The IUPAC name of ethane;3-fluoro-2-methylaniline;methanimine (CID 144871990) is ethane;3-fluoro-2-methylaniline;methanimine.
What is the SMILES notation for ethane;3-fluoro-2-methylaniline;methanimine?
The canonical SMILES for ethane;3-fluoro-2-methylaniline;methanimine is CC.Cc1c(N)cccc1F.[H]N=C.[H]N=C.
What is the InChIKey of ethane;3-fluoro-2-methylaniline;methanimine?
The InChIKey is LHJYSUJFNGEQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN.C2H6.2CH3N/c1-5-6(8)3-2-4-7(5)9;3*1-2/h2-4H,9H2,1H3;1-2H3;2*2H,1H2.
What are the key properties of ethane;3-fluoro-2-methylaniline;methanimine?
ethane;3-fluoro-2-methylaniline;methanimine has a molecular weight of 213.30 g/mol, XLogP of 3.27, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-fluoro-2-methylaniline;methanimine is sourced from PubChem (CID 144871990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).