C10H12N2 — CID 144876038
5-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrimidine (PubChem CID 144876038) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrimidine.
| Compound Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 144876038 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrimidine |
| SMILES | C=C/C=C(\C=C)C1=CNCN=C1 |
| InChI | InChI=1S/C10H12N2/c1-3-5-9(4-2)10-6-11-8-12-7-10/h3-7,11H,1-2,8H2/b9-5+ |
| InChIKey | IBMJGWSZMGVTNY-WEVVVXLNSA-N |
| XLogP | 1.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|