C27H31F7N2O5S — CID 144882316
[3-(4-aminophenyl)sulfonylpyrrolidin-1-yl]-cyclohexylmethanone;formic acid;1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene (PubChem CID 144882316) has the molecular formula C27H31F7N2O5S and a molecular weight of 628.61 g/mol. Its IUPAC name is [3-(4-aminophenyl)sulfonylpyrrolidin-1-yl]-cyclohexylmethanone;formic acid;1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene.
| Compound Name | [3-(4-aminophenyl)sulfonylpyrrolidin-1-yl]-cyclohexylmethanone;formic acid;1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene |
|---|---|
| PubChem CID | 144882316 |
| Molecular Formula | C27H31F7N2O5S |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | [3-(4-aminophenyl)sulfonylpyrrolidin-1-yl]-cyclohexylmethanone;formic acid;1,1,1,2,3,3,3-heptafluoropropan-2-ylbenzene |
| SMILES | FC(F)(F)C(F)(c1ccccc1)C(F)(F)F.Nc1ccc(S(=O)(=O)C2CCN(C(=O)C3CCCCC3)C2)cc1.O=CO |
| InChI | InChI=1S/C17H24N2O3S.C9H5F7.CH2O2/c18-14-6-8-15(9-7-14)23(21,22)16-10-11-19(12-16)17(20)13-4-2-1-3-5-13;10-7(8(11,12)13,9(14,15)16)6-4-2-1-3-5-6;2-1-3/h6-9,13,16H,1-5,10-12,18H2;1-5H;1H,(H,2,3) |
| InChIKey | LAKUHCBFMQDUSF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|