C10H14N4 — CID 144894336
7-methyl-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazin-2-amine (PubChem CID 144894336) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 7-methyl-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazin-2-amine.
| Compound Name | 7-methyl-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazin-2-amine |
|---|---|
| PubChem CID | 144894336 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 7-methyl-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazin-2-amine |
| SMILES | Cc1c[nH]c2ncc(NC(C)C)nc12 |
| InChI | InChI=1S/C10H14N4/c1-6(2)13-8-5-12-10-9(14-8)7(3)4-11-10/h4-6H,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | QIDZMYLLAQNPTJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |