C9H12BN3 — CID 170788920
CID 170788920 (PubChem CID 170788920) has the molecular formula C9H12BN3 and a molecular weight of 173.03 g/mol.
| Compound Name | CID 170788920 |
|---|---|
| PubChem CID | 170788920 |
| Molecular Formula | C9H12BN3 |
| Molecular Weight | 173.03 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | — |
| SMILES | CC.[B]c1cnc2[nH]cc(C)c2n1 |
| InChI | InChI=1S/C7H6BN3.C2H6/c1-4-2-9-7-6(4)11-5(8)3-10-7;1-2/h2-3H,1H3,(H,9,10);1-2H3 |
| InChIKey | GLXFFKQDVSIFKC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.03 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|