C6H3I2N3 — CID 88944324
2,7-diiodo-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 88944324) has the molecular formula C6H3I2N3 and a molecular weight of 370.92 g/mol. Its IUPAC name is 2,7-diiodo-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 2,7-diiodo-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 88944324 |
| Molecular Formula | C6H3I2N3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.84 |
| IUPAC Name | 2,7-diiodo-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | Ic1cnc2[nH]cc(I)c2n1 |
| InChI | InChI=1S/C6H3I2N3/c7-3-1-9-6-5(3)11-4(8)2-10-6/h1-2H,(H,9,10) |
| InChIKey | DFWIJBMKMRRCCP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|