C12H7Cl2IN6 — CID 158480244
2-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine;2-chloro-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 158480244) has the molecular formula C12H7Cl2IN6 and a molecular weight of 433.04 g/mol. Its IUPAC name is 2-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine;2-chloro-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 2-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine;2-chloro-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 158480244 |
| Molecular Formula | C12H7Cl2IN6 |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | 2-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine;2-chloro-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | Clc1cnc2[nH]cc(I)c2n1.Clc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C6H3ClIN3.C6H4ClN3/c7-4-2-10-6-5(11-4)3(8)1-9-6;7-5-3-9-6-4(10-5)1-2-8-6/h1-2H,(H,9,10);1-3H,(H,8,9) |
| InChIKey | HHLABNJSZQHUBQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|