About 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol
3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol (PubChem CID 169486707) has the molecular formula C9H7N3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol.
Molecular Properties
| Compound Name | 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol |
| PubChem CID | 169486707 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol |
| SMILES | SCC#Cc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C9H7N3S/c13-5-1-2-7-6-11-9-8(12-7)3-4-10-9/h3-4,6,13H,5H2,(H,10,11) |
| InChIKey | YNQKYTUVUQPGMM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol?
The IUPAC name of 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol (CID 169486707) is 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol.
What is the SMILES notation for 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol?
The canonical SMILES for 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol is SCC#Cc1cnc2[nH]ccc2n1.
What is the InChIKey of 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol?
The InChIKey is YNQKYTUVUQPGMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S/c13-5-1-2-7-6-11-9-8(12-7)3-4-10-9/h3-4,6,13H,5H2,(H,10,11).
What are the key properties of 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol?
3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol has a molecular weight of 189.24 g/mol, XLogP of 1.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)prop-2-yne-1-thiol is sourced from PubChem (CID 169486707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).