C14H11N3S2 — CID 144895480
2-amino-4-pyridin-3-yl-6-(1,3-thiazol-2-yl)benzenethiol (PubChem CID 144895480) has the molecular formula C14H11N3S2 and a molecular weight of 285.40 g/mol. Its IUPAC name is 2-amino-4-pyridin-3-yl-6-(1,3-thiazol-2-yl)benzenethiol.
| Compound Name | 2-amino-4-pyridin-3-yl-6-(1,3-thiazol-2-yl)benzenethiol |
|---|---|
| PubChem CID | 144895480 |
| Molecular Formula | C14H11N3S2 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-amino-4-pyridin-3-yl-6-(1,3-thiazol-2-yl)benzenethiol |
| SMILES | Nc1cc(-c2cccnc2)cc(-c2nccs2)c1S |
| InChI | InChI=1S/C14H11N3S2/c15-12-7-10(9-2-1-3-16-8-9)6-11(13(12)18)14-17-4-5-19-14/h1-8,18H,15H2 |
| InChIKey | SQZGDBAKWYDOGZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|