C14H20BrN3 — CID 144904005
N-[(4Z)-6-bromo-3-methylidenehepta-1,4,6-trien-2-yl]-N'-methylpyrrolidine-2-carboximidamide (PubChem CID 144904005) has the molecular formula C14H20BrN3 and a molecular weight of 310.24 g/mol. Its IUPAC name is N-[(4Z)-6-bromo-3-methylidenehepta-1,4,6-trien-2-yl]-N'-methylpyrrolidine-2-carboximidamide.
| Compound Name | N-[(4Z)-6-bromo-3-methylidenehepta-1,4,6-trien-2-yl]-N'-methylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 144904005 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[(4Z)-6-bromo-3-methylidenehepta-1,4,6-trien-2-yl]-N'-methylpyrrolidine-2-carboximidamide |
| SMILES | C=C(Br)/C=C\C(=C)C(=C)N/C(=N\C)C1CCCN1 |
| InChI | InChI=1S/C14H20BrN3/c1-10(7-8-11(2)15)12(3)18-14(16-4)13-6-5-9-17-13/h7-8,13,17H,1-3,5-6,9H2,4H3,(H,16,18)/b8-7- |
| InChIKey | WXZAKKUGDFITCQ-FPLPWBNLSA-N |
| XLogP | 2.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|