C12H26N2O4 — CID 144904584
ethane;methyl N-(oxan-4-ylcarbamoyl)carbamate (PubChem CID 144904584) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethane;methyl N-(oxan-4-ylcarbamoyl)carbamate.
| Compound Name | ethane;methyl N-(oxan-4-ylcarbamoyl)carbamate |
|---|---|
| PubChem CID | 144904584 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | ethane;methyl N-(oxan-4-ylcarbamoyl)carbamate |
| SMILES | CC.CC.COC(=O)NC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C8H14N2O4.2C2H6/c1-13-8(12)10-7(11)9-6-2-4-14-5-3-6;2*1-2/h6H,2-5H2,1H3,(H2,9,10,11,12);2*1-2H3 |
| InChIKey | CBHNNYNBUPDRFP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |