C30H37N9OS — CID 144914224
methanimine;prop-2-enal;pyridin-2-ylmethyl 4-[4-amino-6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidine-5-carboximidoyl]benzenecarboximidothioate (PubChem CID 144914224) has the molecular formula C30H37N9OS and a molecular weight of 571.76 g/mol. Its IUPAC name is methanimine;prop-2-enal;pyridin-2-ylmethyl 4-[4-amino-6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidine-5-carboximidoyl]benzenecarboximidothioate.
| Compound Name | methanimine;prop-2-enal;pyridin-2-ylmethyl 4-[4-amino-6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidine-5-carboximidoyl]benzenecarboximidothioate |
|---|---|
| PubChem CID | 144914224 |
| Molecular Formula | C30H37N9OS |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | methanimine;prop-2-enal;pyridin-2-ylmethyl 4-[4-amino-6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)amino]pyrimidine-5-carboximidoyl]benzenecarboximidothioate |
| SMILES | C=CC=O.[H]/N=C(\SCc1ccccn1)c1ccc(/C(=N\[H])c2c(N)ncnc2NC2CC3CN(C)CC3C2)cc1.[H]N=C |
| InChI | InChI=1S/C26H30N8S.C3H4O.CH3N/c1-34-12-18-10-21(11-19(18)13-34)33-26-22(24(28)31-15-32-26)23(27)16-5-7-17(8-6-16)25(29)35-14-20-4-2-3-9-30-20;1-2-3-4;1-2/h2-9,15,18-19,21,27,29H,10-14H2,1H3,(H3,28,31,32,33);2-3H,1H2;2H,1H2/b27-23+,29-25-;; |
| InChIKey | SZHRVMQQSKHOQT-JMUAMCOYSA-N |
| XLogP | 4.52 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|