C20H20F3NO2 — CID 144916287
(2Z,4Z)-2-[(6-ethylnaphthalen-2-yl)amino]-4-(trifluoromethyl)hepta-2,4-dienoic acid (PubChem CID 144916287) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is (2Z,4Z)-2-[(6-ethylnaphthalen-2-yl)amino]-4-(trifluoromethyl)hepta-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-2-[(6-ethylnaphthalen-2-yl)amino]-4-(trifluoromethyl)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144916287 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (2Z,4Z)-2-[(6-ethylnaphthalen-2-yl)amino]-4-(trifluoromethyl)hepta-2,4-dienoic acid |
| SMILES | CC/C=C(/C=C(\Nc1ccc2cc(CC)ccc2c1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C20H20F3NO2/c1-3-5-16(20(21,22)23)12-18(19(25)26)24-17-9-8-14-10-13(4-2)6-7-15(14)11-17/h5-12,24H,3-4H2,1-2H3,(H,25,26)/b16-5-,18-12- |
| InChIKey | AAKRKPPVDJWLMI-TWKWFLLTSA-N |
| XLogP | 5.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|