About tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane
tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane (PubChem CID 144923920) has the molecular formula C28H38FN3O2
and a molecular weight of 467.63 g/mol. Its IUPAC name is tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane.
Molecular Properties
| Compound Name | tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane |
| PubChem CID | 144923920 |
| Molecular Formula | C28H38FN3O2 |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane |
| SMILES | CC(=O)OC(C)(C)C.CCC(C)C.CCc1nc2ccc(-c3c[nH]c4cc(F)ccc34)cc2[nH]1 |
| InChI | InChI=1S/C17H14FN3.C6H12O2.C5H12/c1-2-17-20-14-6-3-10(7-16(14)21-17)13-9-19-15-8-11(18)4-5-12(13)15;1-5(7)8-6(2,3)4;1-4-5(2)3/h3-9,19H,2H2,1H3,(H,20,21);1-4H3;5H,4H2,1-3H3 |
| InChIKey | UGBVKMOIRUQIGL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane?
The IUPAC name of tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane (CID 144923920) is tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane.
What is the SMILES notation for tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane?
The canonical SMILES for tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane is CC(=O)OC(C)(C)C.CCC(C)C.CCc1nc2ccc(-c3c[nH]c4cc(F)ccc34)cc2[nH]1.
What is the InChIKey of tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane?
The InChIKey is UGBVKMOIRUQIGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3.C6H12O2.C5H12/c1-2-17-20-14-6-3-10(7-16(14)21-17)13-9-19-15-8-11(18)4-5-12(13)15;1-5(7)8-6(2,3)4;1-4-5(2)3/h3-9,19H,2H2,1H3,(H,20,21);1-4H3;5H,4H2,1-3H3.
What are the key properties of tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane?
tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane has a molecular weight of 467.63 g/mol, XLogP of 7.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;2-ethyl-6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazole;2-methylbutane is sourced from PubChem (CID 144923920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).